C26H29ClN5O5PS2 — CID 118491195
9-[(2R)-2-[[(3-chlorophenoxy)-[(5R)-5-phenylmethoxydithian-4-yl]oxyphosphoryl]methoxy]propyl]purin-6-amine (PubChem CID 118491195) has the molecular formula C26H29ClN5O5PS2 and a molecular weight of 622.11 g/mol. Its IUPAC name is 9-[(2R)-2-[[(3-chlorophenoxy)-[(5R)-5-phenylmethoxydithian-4-yl]oxyphosphoryl]methoxy]propyl]purin-6-amine.
| Compound Name | 9-[(2R)-2-[[(3-chlorophenoxy)-[(5R)-5-phenylmethoxydithian-4-yl]oxyphosphoryl]methoxy]propyl]purin-6-amine |
|---|---|
| PubChem CID | 118491195 |
| Molecular Formula | C26H29ClN5O5PS2 |
| Molecular Weight | 622.11 g/mol |
| Exact Mass | 621.10 |
| IUPAC Name | 9-[(2R)-2-[[(3-chlorophenoxy)-[(5R)-5-phenylmethoxydithian-4-yl]oxyphosphoryl]methoxy]propyl]purin-6-amine |
| SMILES | C[C@H](Cn1cnc2c(N)ncnc21)OCP(=O)(Oc1cccc(Cl)c1)OC1CSSC[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C26H29ClN5O5PS2/c1-18(11-32-16-31-24-25(28)29-15-30-26(24)32)35-17-38(33,36-21-9-5-8-20(27)10-21)37-23-14-40-39-13-22(23)34-12-19-6-3-2-4-7-19/h2-10,15-16,18,22-23H,11-14,17H2,1H3,(H2,28,29,30)/t18-,22+,23?,38?/m1/s1 |
| InChIKey | DEMOXWFQXPEASQ-RHFLOMSISA-N |
| XLogP | 6.06 |
| TPSA | 123.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.11 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|