C26H30N5O5PS2 — CID 118482831
[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxy-phenylmethyl]-[(4R,5R)-5-phenylmethoxydithian-4-yl]oxyphosphinic acid (PubChem CID 118482831) has the molecular formula C26H30N5O5PS2 and a molecular weight of 587.66 g/mol. Its IUPAC name is [[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxy-phenylmethyl]-[(4R,5R)-5-phenylmethoxydithian-4-yl]oxyphosphinic acid.
| Compound Name | [[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxy-phenylmethyl]-[(4R,5R)-5-phenylmethoxydithian-4-yl]oxyphosphinic acid |
|---|---|
| PubChem CID | 118482831 |
| Molecular Formula | C26H30N5O5PS2 |
| Molecular Weight | 587.66 g/mol |
| Exact Mass | 587.14 |
| IUPAC Name | [[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxy-phenylmethyl]-[(4R,5R)-5-phenylmethoxydithian-4-yl]oxyphosphinic acid |
| SMILES | C[C@H](Cn1cnc2c(N)ncnc21)OC(c1ccccc1)P(=O)(O)O[C@H]1CSSCC1OCc1ccccc1 |
| InChI | InChI=1S/C26H30N5O5PS2/c1-18(12-31-17-30-23-24(27)28-16-29-25(23)31)35-26(20-10-6-3-7-11-20)37(32,33)36-22-15-39-38-14-21(22)34-13-19-8-4-2-5-9-19/h2-11,16-18,21-22,26H,12-15H2,1H3,(H,32,33)(H2,27,28,29)/t18-,21?,22+,26?/m1/s1 |
| InChIKey | HJVXMUSEXGEISX-MWQDMMJZSA-N |
| XLogP | 5.06 |
| TPSA | 134.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.66 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|