C14H20N5O5P — CID 141232323
2-(6-aminopurin-9-yl)ethoxymethylidene-(2,2-dimethylpropanoyloxymethoxy)-oxidophosphanium (PubChem CID 141232323) has the molecular formula C14H20N5O5P and a molecular weight of 369.32 g/mol. Its IUPAC name is 2-(6-aminopurin-9-yl)ethoxymethylidene-(2,2-dimethylpropanoyloxymethoxy)-oxidophosphanium.
| Compound Name | 2-(6-aminopurin-9-yl)ethoxymethylidene-(2,2-dimethylpropanoyloxymethoxy)-oxidophosphanium |
|---|---|
| PubChem CID | 141232323 |
| Molecular Formula | C14H20N5O5P |
| Molecular Weight | 369.32 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 2-(6-aminopurin-9-yl)ethoxymethylidene-(2,2-dimethylpropanoyloxymethoxy)-oxidophosphanium |
| SMILES | CC(C)(C)C(=O)OCO[P+]([O-])=COCCn1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C14H20N5O5P/c1-14(2,3)13(20)23-8-24-25(21)9-22-5-4-19-7-18-10-11(15)16-6-17-12(10)19/h6-7,9H,4-5,8H2,1-3H3,(H2,15,16,17) |
| InChIKey | IPIJFSWYLJPDOG-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 137.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.32 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|