C15H22N6O4 — CID 57241811
(2-methylpropan-2-yl)oxycarbonyl 2-amino-4-(6-aminopurin-9-yl)-2-methylbutanoate (PubChem CID 57241811) has the molecular formula C15H22N6O4 and a molecular weight of 350.38 g/mol. Its IUPAC name is (2-methylpropan-2-yl)oxycarbonyl 2-amino-4-(6-aminopurin-9-yl)-2-methylbutanoate.
| Compound Name | (2-methylpropan-2-yl)oxycarbonyl 2-amino-4-(6-aminopurin-9-yl)-2-methylbutanoate |
|---|---|
| PubChem CID | 57241811 |
| Molecular Formula | C15H22N6O4 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | (2-methylpropan-2-yl)oxycarbonyl 2-amino-4-(6-aminopurin-9-yl)-2-methylbutanoate |
| SMILES | CC(C)(C)OC(=O)OC(=O)C(C)(N)CCn1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C15H22N6O4/c1-14(2,3)25-13(23)24-12(22)15(4,17)5-6-21-8-20-9-10(16)18-7-19-11(9)21/h7-8H,5-6,17H2,1-4H3,(H2,16,18,19) |
| InChIKey | KCPOQERWVPGYKS-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 148.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|