C26H39ClFN5O14P2 — CID 130441477
bis(propan-2-yloxycarbonyloxymethoxy)phosphorylmethyl-[[(2R,3R,5R)-5-[2-chloro-6-(cyclopentylamino)purin-9-yl]-4-fluoro-3-hydroxyoxolan-2-yl]methoxy]phosphinic acid (PubChem CID 130441477) has the molecular formula C26H39ClFN5O14P2 and a molecular weight of 762.02 g/mol. Its IUPAC name is bis(propan-2-yloxycarbonyloxymethoxy)phosphorylmethyl-[[(2R,3R,5R)-5-[2-chloro-6-(cyclopentylamino)purin-9-yl]-4-fluoro-3-hydroxyoxolan-2-yl]methoxy]phosphinic acid.
| Compound Name | bis(propan-2-yloxycarbonyloxymethoxy)phosphorylmethyl-[[(2R,3R,5R)-5-[2-chloro-6-(cyclopentylamino)purin-9-yl]-4-fluoro-3-hydroxyoxolan-2-yl]methoxy]phosphinic acid |
|---|---|
| PubChem CID | 130441477 |
| Molecular Formula | C26H39ClFN5O14P2 |
| Molecular Weight | 762.02 g/mol |
| Exact Mass | 761.16 |
| IUPAC Name | bis(propan-2-yloxycarbonyloxymethoxy)phosphorylmethyl-[[(2R,3R,5R)-5-[2-chloro-6-(cyclopentylamino)purin-9-yl]-4-fluoro-3-hydroxyoxolan-2-yl]methoxy]phosphinic acid |
| SMILES | CC(C)OC(=O)OCOP(=O)(CP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(NC4CCCC4)nc(Cl)nc32)C(F)[C@@H]1O)OCOC(=O)OC(C)C |
| InChI | InChI=1S/C26H39ClFN5O14P2/c1-14(2)45-25(35)40-11-43-49(39,44-12-41-26(36)46-15(3)4)13-48(37,38)42-9-17-20(34)18(28)23(47-17)33-10-29-19-21(30-16-7-5-6-8-16)31-24(27)32-22(19)33/h10,14-18,20,23,34H,5-9,11-13H2,1-4H3,(H,37,38)(H,30,31,32)/t17-,18?,20-,23-/m1/s1 |
| InChIKey | BXCLVMGKSFNTSP-NOJOORHWSA-N |
| XLogP | 4.85 |
| TPSA | 238.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.02 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|