C22H34ClN4O8P — CID 166786669
[(2S,5R)-5-[2-chloro-4-(pentylamino)pyrrolo[2,3-d]pyrimidin-7-yl]oxolan-2-yl]methoxymethyl-(propan-2-yloxycarbonyloxymethoxy)phosphinic acid (PubChem CID 166786669) has the molecular formula C22H34ClN4O8P and a molecular weight of 548.96 g/mol. Its IUPAC name is [(2S,5R)-5-[2-chloro-4-(pentylamino)pyrrolo[2,3-d]pyrimidin-7-yl]oxolan-2-yl]methoxymethyl-(propan-2-yloxycarbonyloxymethoxy)phosphinic acid.
| Compound Name | [(2S,5R)-5-[2-chloro-4-(pentylamino)pyrrolo[2,3-d]pyrimidin-7-yl]oxolan-2-yl]methoxymethyl-(propan-2-yloxycarbonyloxymethoxy)phosphinic acid |
|---|---|
| PubChem CID | 166786669 |
| Molecular Formula | C22H34ClN4O8P |
| Molecular Weight | 548.96 g/mol |
| Exact Mass | 548.18 |
| IUPAC Name | [(2S,5R)-5-[2-chloro-4-(pentylamino)pyrrolo[2,3-d]pyrimidin-7-yl]oxolan-2-yl]methoxymethyl-(propan-2-yloxycarbonyloxymethoxy)phosphinic acid |
| SMILES | CCCCCNc1nc(Cl)nc2c1ccn2[C@H]1CC[C@@H](COCP(=O)(O)OCOC(=O)OC(C)C)O1 |
| InChI | InChI=1S/C22H34ClN4O8P/c1-4-5-6-10-24-19-17-9-11-27(20(17)26-21(23)25-19)18-8-7-16(35-18)12-31-14-36(29,30)33-13-32-22(28)34-15(2)3/h9,11,15-16,18H,4-8,10,12-14H2,1-3H3,(H,29,30)(H,24,25,26)/t16-,18+/m0/s1 |
| InChIKey | CJZGKRUQYVIVDJ-FUHWJXTLSA-N |
| XLogP | 5.06 |
| TPSA | 143.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.96 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|