C26H46ClN4O6P — CID 142446158
2-chloro-N-cyclopentyl-7-[5-(diethoxyphosphanylmethoxymethyl)oxolan-2-yl]pyrrolo[2,3-d]pyrimidin-4-amine;ethane;propane-2,2-diol (PubChem CID 142446158) has the molecular formula C26H46ClN4O6P and a molecular weight of 577.10 g/mol. Its IUPAC name is 2-chloro-N-cyclopentyl-7-[5-(diethoxyphosphanylmethoxymethyl)oxolan-2-yl]pyrrolo[2,3-d]pyrimidin-4-amine;ethane;propane-2,2-diol.
| Compound Name | 2-chloro-N-cyclopentyl-7-[5-(diethoxyphosphanylmethoxymethyl)oxolan-2-yl]pyrrolo[2,3-d]pyrimidin-4-amine;ethane;propane-2,2-diol |
|---|---|
| PubChem CID | 142446158 |
| Molecular Formula | C26H46ClN4O6P |
| Molecular Weight | 577.10 g/mol |
| Exact Mass | 576.28 |
| IUPAC Name | 2-chloro-N-cyclopentyl-7-[5-(diethoxyphosphanylmethoxymethyl)oxolan-2-yl]pyrrolo[2,3-d]pyrimidin-4-amine;ethane;propane-2,2-diol |
| SMILES | CC.CC(C)(O)O.CCOP(COCC1CCC(n2ccc3c(NC4CCCC4)nc(Cl)nc32)O1)OCC |
| InChI | InChI=1S/C21H32ClN4O4P.C3H8O2.C2H6/c1-3-28-31(29-4-2)14-27-13-16-9-10-18(30-16)26-12-11-17-19(23-15-7-5-6-8-15)24-21(22)25-20(17)26;1-3(2,4)5;1-2/h11-12,15-16,18H,3-10,13-14H2,1-2H3,(H,23,24,25);4-5H,1-2H3;1-2H3 |
| InChIKey | JLANMDIORJCXTR-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 120.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.10 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|