C20H31ClN5O9PS — CID 153359006
[2-[[(2R,3S,4R,5R)-5-[2-chloro-4-(cyclopentylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-(methanesulfonamido)propan-2-yl]phosphonic acid (PubChem CID 153359006) has the molecular formula C20H31ClN5O9PS and a molecular weight of 583.99 g/mol. Its IUPAC name is [2-[[(2R,3S,4R,5R)-5-[2-chloro-4-(cyclopentylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-(methanesulfonamido)propan-2-yl]phosphonic acid.
| Compound Name | [2-[[(2R,3S,4R,5R)-5-[2-chloro-4-(cyclopentylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-(methanesulfonamido)propan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 153359006 |
| Molecular Formula | C20H31ClN5O9PS |
| Molecular Weight | 583.99 g/mol |
| Exact Mass | 583.13 |
| IUPAC Name | [2-[[(2R,3S,4R,5R)-5-[2-chloro-4-(cyclopentylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-(methanesulfonamido)propan-2-yl]phosphonic acid |
| SMILES | CC(CNS(C)(=O)=O)(OC[C@H]1O[C@@H](n2ccc3c(NC4CCCC4)nc(Cl)nc32)[C@H](O)[C@@H]1O)P(=O)(O)O |
| InChI | InChI=1S/C20H31ClN5O9PS/c1-20(36(29,30)31,10-22-37(2,32)33)34-9-13-14(27)15(28)18(35-13)26-8-7-12-16(23-11-5-3-4-6-11)24-19(21)25-17(12)26/h7-8,11,13-15,18,22,27-28H,3-6,9-10H2,1-2H3,(H,23,24,25)(H2,29,30,31)/t13-,14-,15-,18-,20?/m1/s1 |
| InChIKey | XFOHIZINULWAAB-FSXPKSEBSA-N |
| XLogP | 0.52 |
| TPSA | 205.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.99 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|