C23H34ClN4O10PS — CID 146472997
[(2S,3S,4R,5R)-5-[2-chloro-4-(cyclopentylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethyl-(2,2-dimethylpropanoyloxymethoxy)phosphinic acid (PubChem CID 146472997) has the molecular formula C23H34ClN4O10PS and a molecular weight of 625.04 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-5-[2-chloro-4-(cyclopentylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethyl-(2,2-dimethylpropanoyloxymethoxy)phosphinic acid.
| Compound Name | [(2S,3S,4R,5R)-5-[2-chloro-4-(cyclopentylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethyl-(2,2-dimethylpropanoyloxymethoxy)phosphinic acid |
|---|---|
| PubChem CID | 146472997 |
| Molecular Formula | C23H34ClN4O10PS |
| Molecular Weight | 625.04 g/mol |
| Exact Mass | 624.14 |
| IUPAC Name | [(2S,3S,4R,5R)-5-[2-chloro-4-(cyclopentylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethyl-(2,2-dimethylpropanoyloxymethoxy)phosphinic acid |
| SMILES | CC(C)(C)C(=O)OCOP(=O)(O)CS(=O)(=O)C[C@H]1O[C@@H](n2ccc3c(NC4CCCC4)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H34ClN4O10PS/c1-23(2,3)21(31)36-11-37-39(32,33)12-40(34,35)10-15-16(29)17(30)20(38-15)28-9-8-14-18(25-13-6-4-5-7-13)26-22(24)27-19(14)28/h8-9,13,15-17,20,29-30H,4-7,10-12H2,1-3H3,(H,32,33)(H,25,26,27)/t15-,16-,17-,20-/m1/s1 |
| InChIKey | DHWRGSAXFDWGSN-WOCWXWTJSA-N |
| XLogP | 2.18 |
| TPSA | 199.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.04 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|