C17H24ClN4O8P — CID 166784065
[(2R,3S,4R,5R)-5-[2-chloro-4-(oxan-4-ylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methylperoxy-methylphosphinic acid (PubChem CID 166784065) has the molecular formula C17H24ClN4O8P and a molecular weight of 478.83 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[2-chloro-4-(oxan-4-ylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methylperoxy-methylphosphinic acid.
| Compound Name | [(2R,3S,4R,5R)-5-[2-chloro-4-(oxan-4-ylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methylperoxy-methylphosphinic acid |
|---|---|
| PubChem CID | 166784065 |
| Molecular Formula | C17H24ClN4O8P |
| Molecular Weight | 478.83 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[2-chloro-4-(oxan-4-ylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methylperoxy-methylphosphinic acid |
| SMILES | CP(=O)(O)OOC[C@H]1O[C@@H](n2ccc3c(NC4CCOCC4)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H24ClN4O8P/c1-31(25,26)30-28-8-11-12(23)13(24)16(29-11)22-5-2-10-14(20-17(18)21-15(10)22)19-9-3-6-27-7-4-9/h2,5,9,11-13,16,23-24H,3-4,6-8H2,1H3,(H,25,26)(H,19,20,21)/t11-,12-,13-,16-/m1/s1 |
| InChIKey | VHWRVPBNFLUVPN-BRXULGCHSA-N |
| XLogP | 1.06 |
| TPSA | 157.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.83 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|