C20H27N4O8P — CID 166783972
[(2R,3S,4R,5R)-5-[4-(cyclopentylamino)-2-(3-hydroxyprop-1-ynyl)pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methylperoxy-methylphosphinic acid (PubChem CID 166783972) has the molecular formula C20H27N4O8P and a molecular weight of 482.43 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[4-(cyclopentylamino)-2-(3-hydroxyprop-1-ynyl)pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methylperoxy-methylphosphinic acid.
| Compound Name | [(2R,3S,4R,5R)-5-[4-(cyclopentylamino)-2-(3-hydroxyprop-1-ynyl)pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methylperoxy-methylphosphinic acid |
|---|---|
| PubChem CID | 166783972 |
| Molecular Formula | C20H27N4O8P |
| Molecular Weight | 482.43 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[4-(cyclopentylamino)-2-(3-hydroxyprop-1-ynyl)pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methylperoxy-methylphosphinic acid |
| SMILES | CP(=O)(O)OOC[C@H]1O[C@@H](n2ccc3c(NC4CCCC4)nc(C#CCO)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H27N4O8P/c1-33(28,29)32-30-11-14-16(26)17(27)20(31-14)24-9-8-13-18(21-12-5-2-3-6-12)22-15(7-4-10-25)23-19(13)24/h8-9,12,14,16-17,20,25-27H,2-3,5-6,10-11H2,1H3,(H,28,29)(H,21,22,23)/t14-,16-,17-,20-/m1/s1 |
| InChIKey | HWHHSXAMJKKOCS-WVSUBDOOSA-N |
| XLogP | 0.51 |
| TPSA | 168.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.43 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|