C18H27N4O8P — CID 166784047
[(2R,3S,4R,5R)-5-[4-(cyclopentylamino)-2-methoxypyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methylperoxy-methylphosphinic acid (PubChem CID 166784047) has the molecular formula C18H27N4O8P and a molecular weight of 458.41 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[4-(cyclopentylamino)-2-methoxypyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methylperoxy-methylphosphinic acid.
| Compound Name | [(2R,3S,4R,5R)-5-[4-(cyclopentylamino)-2-methoxypyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methylperoxy-methylphosphinic acid |
|---|---|
| PubChem CID | 166784047 |
| Molecular Formula | C18H27N4O8P |
| Molecular Weight | 458.41 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[4-(cyclopentylamino)-2-methoxypyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methylperoxy-methylphosphinic acid |
| SMILES | COc1nc(NC2CCCC2)c2ccn([C@@H]3O[C@H](COOP(C)(=O)O)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C18H27N4O8P/c1-27-18-20-15(19-10-5-3-4-6-10)11-7-8-22(16(11)21-18)17-14(24)13(23)12(29-17)9-28-30-31(2,25)26/h7-8,10,12-14,17,23-24H,3-6,9H2,1-2H3,(H,25,26)(H,19,20,21)/t12-,13-,14-,17-/m1/s1 |
| InChIKey | UAIHWSQEXKKYQD-VMUDFCTBSA-N |
| XLogP | 1.18 |
| TPSA | 157.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.41 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|