C20H31N4O9P — CID 175890136
[[(2R,3S,4R,5R)-5-[4-(cyclopentylamino)-2-(3-hydroxypropoxy)pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]-methoxymethyl]phosphonic acid (PubChem CID 175890136) has the molecular formula C20H31N4O9P and a molecular weight of 502.46 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-[4-(cyclopentylamino)-2-(3-hydroxypropoxy)pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]-methoxymethyl]phosphonic acid.
| Compound Name | [[(2R,3S,4R,5R)-5-[4-(cyclopentylamino)-2-(3-hydroxypropoxy)pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]-methoxymethyl]phosphonic acid |
|---|---|
| PubChem CID | 175890136 |
| Molecular Formula | C20H31N4O9P |
| Molecular Weight | 502.46 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-[4-(cyclopentylamino)-2-(3-hydroxypropoxy)pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]-methoxymethyl]phosphonic acid |
| SMILES | COC([C@@H]1O[C@@H](n2ccc3c(NC4CCCC4)nc(OCCCO)nc32)[C@H](O)[C@@H]1O)P(=O)(O)O |
| InChI | InChI=1S/C20H31N4O9P/c1-31-19(34(28,29)30)15-13(26)14(27)18(33-15)24-8-7-12-16(21-11-5-2-3-6-11)22-20(23-17(12)24)32-10-4-9-25/h7-8,11,13-15,18-19,25-27H,2-6,9-10H2,1H3,(H,21,22,23)(H2,28,29,30)/t13-,14+,15+,18+,19?/m0/s1 |
| InChIKey | ONIOAEDLDPGWSL-MHXYQDAESA-N |
| XLogP | 0.32 |
| TPSA | 188.65 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.46 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|