C23H34ClN4O8P — CID 146473005
[(2R,3S,4R,5R)-5-[2-chloro-4-(cyclopentylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethyl-(3,3-dimethyl-2-oxobutoxy)phosphinic acid (PubChem CID 146473005) has the molecular formula C23H34ClN4O8P and a molecular weight of 560.97 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[2-chloro-4-(cyclopentylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethyl-(3,3-dimethyl-2-oxobutoxy)phosphinic acid.
| Compound Name | [(2R,3S,4R,5R)-5-[2-chloro-4-(cyclopentylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethyl-(3,3-dimethyl-2-oxobutoxy)phosphinic acid |
|---|---|
| PubChem CID | 146473005 |
| Molecular Formula | C23H34ClN4O8P |
| Molecular Weight | 560.97 g/mol |
| Exact Mass | 560.18 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[2-chloro-4-(cyclopentylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethyl-(3,3-dimethyl-2-oxobutoxy)phosphinic acid |
| SMILES | CC(C)(C)C(=O)COP(=O)(O)COC[C@H]1O[C@@H](n2ccc3c(NC4CCCC4)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H34ClN4O8P/c1-23(2,3)16(29)11-35-37(32,33)12-34-10-15-17(30)18(31)21(36-15)28-9-8-14-19(25-13-6-4-5-7-13)26-22(24)27-20(14)28/h8-9,13,15,17-18,21,30-31H,4-7,10-12H2,1-3H3,(H,32,33)(H,25,26,27)/t15-,17-,18-,21-/m1/s1 |
| InChIKey | LFWRUFKWCRZNTQ-QTQZEZTPSA-N |
| XLogP | 2.85 |
| TPSA | 165.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.97 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|