C22H32ClN4O8P — CID 161173356
[(2R,3S,4R,5R)-5-[2-chloro-4-(cyclopentylmethyl)pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethyl-[2-(dimethylamino)-2-oxoethoxy]phosphinic acid (PubChem CID 161173356) has the molecular formula C22H32ClN4O8P and a molecular weight of 546.95 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[2-chloro-4-(cyclopentylmethyl)pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethyl-[2-(dimethylamino)-2-oxoethoxy]phosphinic acid.
| Compound Name | [(2R,3S,4R,5R)-5-[2-chloro-4-(cyclopentylmethyl)pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethyl-[2-(dimethylamino)-2-oxoethoxy]phosphinic acid |
|---|---|
| PubChem CID | 161173356 |
| Molecular Formula | C22H32ClN4O8P |
| Molecular Weight | 546.95 g/mol |
| Exact Mass | 546.16 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[2-chloro-4-(cyclopentylmethyl)pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethyl-[2-(dimethylamino)-2-oxoethoxy]phosphinic acid |
| SMILES | CN(C)C(=O)COP(=O)(O)COC[C@H]1O[C@@H](n2ccc3c(CC4CCCC4)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H32ClN4O8P/c1-26(2)17(28)11-34-36(31,32)12-33-10-16-18(29)19(30)21(35-16)27-8-7-14-15(9-13-5-3-4-6-13)24-22(23)25-20(14)27/h7-8,13,16,18-19,21,29-30H,3-6,9-12H2,1-2H3,(H,31,32)/t16-,18-,19-,21-/m1/s1 |
| InChIKey | URMCUKDSWCNPPS-XLBJILASSA-N |
| XLogP | 1.70 |
| TPSA | 156.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.95 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|