C20H26ClN3O4 — CID 162017909
[(3aR,4R,6R,6aR)-4-[2-chloro-4-(cyclopentylmethyl)pyrrolo[2,3-d]pyrimidin-7-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol (PubChem CID 162017909) has the molecular formula C20H26ClN3O4 and a molecular weight of 407.90 g/mol. Its IUPAC name is [(3aR,4R,6R,6aR)-4-[2-chloro-4-(cyclopentylmethyl)pyrrolo[2,3-d]pyrimidin-7-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol.
| Compound Name | [(3aR,4R,6R,6aR)-4-[2-chloro-4-(cyclopentylmethyl)pyrrolo[2,3-d]pyrimidin-7-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol |
|---|---|
| PubChem CID | 162017909 |
| Molecular Formula | C20H26ClN3O4 |
| Molecular Weight | 407.90 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | [(3aR,4R,6R,6aR)-4-[2-chloro-4-(cyclopentylmethyl)pyrrolo[2,3-d]pyrimidin-7-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](CO)O[C@H]2n1ccc2c(CC3CCCC3)nc(Cl)nc21 |
| InChI | InChI=1S/C20H26ClN3O4/c1-20(2)27-15-14(10-25)26-18(16(15)28-20)24-8-7-12-13(9-11-5-3-4-6-11)22-19(21)23-17(12)24/h7-8,11,14-16,18,25H,3-6,9-10H2,1-2H3/t14-,15-,16-,18-/m1/s1 |
| InChIKey | NCVZSWLRDIHZSM-YFHUEUNASA-N |
| XLogP | 3.23 |
| TPSA | 78.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.90 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |