C22H32ClN4O9P — CID 146472804
[(2R,3S,4R,5R)-5-[2-chloro-4-(cyclopentylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethyl-(2-methylpropanoyloxymethoxy)phosphinic acid (PubChem CID 146472804) has the molecular formula C22H32ClN4O9P and a molecular weight of 562.94 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[2-chloro-4-(cyclopentylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethyl-(2-methylpropanoyloxymethoxy)phosphinic acid.
| Compound Name | [(2R,3S,4R,5R)-5-[2-chloro-4-(cyclopentylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethyl-(2-methylpropanoyloxymethoxy)phosphinic acid |
|---|---|
| PubChem CID | 146472804 |
| Molecular Formula | C22H32ClN4O9P |
| Molecular Weight | 562.94 g/mol |
| Exact Mass | 562.16 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[2-chloro-4-(cyclopentylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethyl-(2-methylpropanoyloxymethoxy)phosphinic acid |
| SMILES | CC(C)C(=O)OCOP(=O)(O)COC[C@H]1O[C@@H](n2ccc3c(NC4CCCC4)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H32ClN4O9P/c1-12(2)21(30)34-10-35-37(31,32)11-33-9-15-16(28)17(29)20(36-15)27-8-7-14-18(24-13-5-3-4-6-13)25-22(23)26-19(14)27/h7-8,12-13,15-17,20,28-29H,3-6,9-11H2,1-2H3,(H,31,32)(H,24,25,26)/t15-,16-,17-,20-/m1/s1 |
| InChIKey | BHHXUFDLVOWYGG-WOCWXWTJSA-N |
| XLogP | 2.39 |
| TPSA | 174.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.94 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|