C17H24IN4O7P — CID 146473190
[(2R,3S,4R,5R)-5-[4-(cyclopentylamino)-2-iodopyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid (PubChem CID 146473190) has the molecular formula C17H24IN4O7P and a molecular weight of 554.28 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[4-(cyclopentylamino)-2-iodopyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid.
| Compound Name | [(2R,3S,4R,5R)-5-[4-(cyclopentylamino)-2-iodopyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid |
|---|---|
| PubChem CID | 146473190 |
| Molecular Formula | C17H24IN4O7P |
| Molecular Weight | 554.28 g/mol |
| Exact Mass | 554.04 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[4-(cyclopentylamino)-2-iodopyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid |
| SMILES | O=P(O)(O)COC[C@H]1O[C@@H](n2ccc3c(NC4CCCC4)nc(I)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H24IN4O7P/c18-17-20-14(19-9-3-1-2-4-9)10-5-6-22(15(10)21-17)16-13(24)12(23)11(29-16)7-28-8-30(25,26)27/h5-6,9,11-13,16,23-24H,1-4,7-8H2,(H,19,20,21)(H2,25,26,27)/t11-,12-,13-,16-/m1/s1 |
| InChIKey | AYEGIGWQLNQEOX-BRXULGCHSA-N |
| XLogP | 1.16 |
| TPSA | 159.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.28 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|