C20H28ClN4O10P — CID 166784050
[[(2R,3S,4R,5R)-5-[2-chloro-4-(cyclopentylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methylperoxy-methylphosphoryl]oxymethyl methyl carbonate (PubChem CID 166784050) has the molecular formula C20H28ClN4O10P and a molecular weight of 550.89 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-[2-chloro-4-(cyclopentylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methylperoxy-methylphosphoryl]oxymethyl methyl carbonate.
| Compound Name | [[(2R,3S,4R,5R)-5-[2-chloro-4-(cyclopentylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methylperoxy-methylphosphoryl]oxymethyl methyl carbonate |
|---|---|
| PubChem CID | 166784050 |
| Molecular Formula | C20H28ClN4O10P |
| Molecular Weight | 550.89 g/mol |
| Exact Mass | 550.12 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-[2-chloro-4-(cyclopentylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methylperoxy-methylphosphoryl]oxymethyl methyl carbonate |
| SMILES | COC(=O)OCOP(C)(=O)OOC[C@H]1O[C@@H](n2ccc3c(NC4CCCC4)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H28ClN4O10P/c1-30-20(28)31-10-33-36(2,29)35-32-9-13-14(26)15(27)18(34-13)25-8-7-12-16(22-11-5-3-4-6-11)23-19(21)24-17(12)25/h7-8,11,13-15,18,26-27H,3-6,9-10H2,1-2H3,(H,22,23,24)/t13-,14-,15-,18-,36?/m1/s1 |
| InChIKey | VQHRZZSWTDBAJK-WTDHCDANSA-N |
| XLogP | 2.59 |
| TPSA | 172.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.89 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|