C22H27ClN5O7P — CID 166784027
(2R,3R,4S,5R)-2-[2-chloro-4-(cyclopentylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-5-[[methyl(pyridin-3-yloxy)phosphoryl]peroxymethyl]oxolane-3,4-diol (PubChem CID 166784027) has the molecular formula C22H27ClN5O7P and a molecular weight of 539.91 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[2-chloro-4-(cyclopentylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-5-[[methyl(pyridin-3-yloxy)phosphoryl]peroxymethyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[2-chloro-4-(cyclopentylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-5-[[methyl(pyridin-3-yloxy)phosphoryl]peroxymethyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 166784027 |
| Molecular Formula | C22H27ClN5O7P |
| Molecular Weight | 539.91 g/mol |
| Exact Mass | 539.13 |
| IUPAC Name | (2R,3R,4S,5R)-2-[2-chloro-4-(cyclopentylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-5-[[methyl(pyridin-3-yloxy)phosphoryl]peroxymethyl]oxolane-3,4-diol |
| SMILES | CP(=O)(OOC[C@H]1O[C@@H](n2ccc3c(NC4CCCC4)nc(Cl)nc32)[C@H](O)[C@@H]1O)Oc1cccnc1 |
| InChI | InChI=1S/C22H27ClN5O7P/c1-36(31,34-14-7-4-9-24-11-14)35-32-12-16-17(29)18(30)21(33-16)28-10-8-15-19(25-13-5-2-3-6-13)26-22(23)27-20(15)28/h4,7-11,13,16-18,21,29-30H,2-3,5-6,12H2,1H3,(H,25,26,27)/t16-,17-,18-,21-,36?/m1/s1 |
| InChIKey | NCAJAIHBWHFQIU-VHJMZZJISA-N |
| XLogP | 3.30 |
| TPSA | 150.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.91 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|