C18H24ClN4O7P — CID 166784002
[(2R,3S,4R,5R)-5-[4-(3-bicyclo[3.1.0]hexanylamino)-2-chloropyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methylperoxy-methylphosphinic acid (PubChem CID 166784002) has the molecular formula C18H24ClN4O7P and a molecular weight of 474.84 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[4-(3-bicyclo[3.1.0]hexanylamino)-2-chloropyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methylperoxy-methylphosphinic acid.
| Compound Name | [(2R,3S,4R,5R)-5-[4-(3-bicyclo[3.1.0]hexanylamino)-2-chloropyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methylperoxy-methylphosphinic acid |
|---|---|
| PubChem CID | 166784002 |
| Molecular Formula | C18H24ClN4O7P |
| Molecular Weight | 474.84 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[4-(3-bicyclo[3.1.0]hexanylamino)-2-chloropyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methylperoxy-methylphosphinic acid |
| SMILES | CP(=O)(O)OOC[C@H]1O[C@@H](n2ccc3c(NC4CC5CC5C4)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H24ClN4O7P/c1-31(26,27)30-28-7-12-13(24)14(25)17(29-12)23-3-2-11-15(21-18(19)22-16(11)23)20-10-5-8-4-9(8)6-10/h2-3,8-10,12-14,17,24-25H,4-7H2,1H3,(H,26,27)(H,20,21,22)/t8?,9?,10?,12-,13-,14-,17-/m1/s1 |
| InChIKey | MJKIUFQHIGLHBF-NNRWPYERSA-N |
| XLogP | 1.68 |
| TPSA | 148.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.84 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|