C26H33ClN3O11P — CID 159105298
[acetyloxymethoxy-[[(2R,3S,4R,5R)-5-[6-chloro-5-cyano-4-(cyclopentylmethyl)pyrrolo[2,3-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethyl]phosphoryl]oxymethyl acetate (PubChem CID 159105298) has the molecular formula C26H33ClN3O11P and a molecular weight of 629.99 g/mol. Its IUPAC name is [acetyloxymethoxy-[[(2R,3S,4R,5R)-5-[6-chloro-5-cyano-4-(cyclopentylmethyl)pyrrolo[2,3-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethyl]phosphoryl]oxymethyl acetate.
| Compound Name | [acetyloxymethoxy-[[(2R,3S,4R,5R)-5-[6-chloro-5-cyano-4-(cyclopentylmethyl)pyrrolo[2,3-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethyl]phosphoryl]oxymethyl acetate |
|---|---|
| PubChem CID | 159105298 |
| Molecular Formula | C26H33ClN3O11P |
| Molecular Weight | 629.99 g/mol |
| Exact Mass | 629.15 |
| IUPAC Name | [acetyloxymethoxy-[[(2R,3S,4R,5R)-5-[6-chloro-5-cyano-4-(cyclopentylmethyl)pyrrolo[2,3-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethyl]phosphoryl]oxymethyl acetate |
| SMILES | CC(=O)OCOP(=O)(COC[C@H]1O[C@@H](n2ccc3c(CC4CCCC4)c(C#N)c(Cl)nc32)[C@H](O)[C@@H]1O)OCOC(C)=O |
| InChI | InChI=1S/C26H33ClN3O11P/c1-15(31)37-12-39-42(35,40-13-38-16(2)32)14-36-11-21-22(33)23(34)26(41-21)30-8-7-18-19(9-17-5-3-4-6-17)20(10-28)24(27)29-25(18)30/h7-8,17,21-23,26,33-34H,3-6,9,11-14H2,1-2H3/t21-,22-,23-,26-/m1/s1 |
| InChIKey | KDUOXKRTQFWEBC-ICLZECGLSA-N |
| XLogP | 3.15 |
| TPSA | 188.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.99 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|