C21H25ClN3O8PS — CID 157199779
[(2S,3S,4R,5R)-5-[6-chloro-5-cyano-4-(spiro[2.3]hexan-5-ylmethyl)pyrrolo[2,3-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid (PubChem CID 157199779) has the molecular formula C21H25ClN3O8PS and a molecular weight of 545.94 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-5-[6-chloro-5-cyano-4-(spiro[2.3]hexan-5-ylmethyl)pyrrolo[2,3-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid.
| Compound Name | [(2S,3S,4R,5R)-5-[6-chloro-5-cyano-4-(spiro[2.3]hexan-5-ylmethyl)pyrrolo[2,3-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid |
|---|---|
| PubChem CID | 157199779 |
| Molecular Formula | C21H25ClN3O8PS |
| Molecular Weight | 545.94 g/mol |
| Exact Mass | 545.08 |
| IUPAC Name | [(2S,3S,4R,5R)-5-[6-chloro-5-cyano-4-(spiro[2.3]hexan-5-ylmethyl)pyrrolo[2,3-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid |
| SMILES | N#Cc1c(Cl)nc2c(ccn2[C@@H]2O[C@H](CS(=O)(=O)CP(=O)(O)O)[C@@H](O)[C@H]2O)c1CC1CC2(CC2)C1 |
| InChI | InChI=1S/C21H25ClN3O8PS/c22-18-14(8-23)13(5-11-6-21(7-11)2-3-21)12-1-4-25(19(12)24-18)20-17(27)16(26)15(33-20)9-35(31,32)10-34(28,29)30/h1,4,11,15-17,20,26-27H,2-3,5-7,9-10H2,(H2,28,29,30)/t15-,16-,17-,20-/m1/s1 |
| InChIKey | AQRAIYYUZBJMJZ-WOCWXWTJSA-N |
| XLogP | 1.46 |
| TPSA | 182.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.94 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|