C23H23ClN5O8PS — CID 162076470
[(2S,3S,4R,5R)-5-[6-chloro-5-cyano-4-[[(1R)-1-(3-cyanophenyl)ethyl]amino]pyrrolo[2,3-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid (PubChem CID 162076470) has the molecular formula C23H23ClN5O8PS and a molecular weight of 595.96 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-5-[6-chloro-5-cyano-4-[[(1R)-1-(3-cyanophenyl)ethyl]amino]pyrrolo[2,3-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid.
| Compound Name | [(2S,3S,4R,5R)-5-[6-chloro-5-cyano-4-[[(1R)-1-(3-cyanophenyl)ethyl]amino]pyrrolo[2,3-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid |
|---|---|
| PubChem CID | 162076470 |
| Molecular Formula | C23H23ClN5O8PS |
| Molecular Weight | 595.96 g/mol |
| Exact Mass | 595.07 |
| IUPAC Name | [(2S,3S,4R,5R)-5-[6-chloro-5-cyano-4-[[(1R)-1-(3-cyanophenyl)ethyl]amino]pyrrolo[2,3-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid |
| SMILES | C[C@@H](Nc1c(C#N)c(Cl)nc2c1ccn2[C@@H]1O[C@H](CS(=O)(=O)CP(=O)(O)O)[C@@H](O)[C@H]1O)c1cccc(C#N)c1 |
| InChI | InChI=1S/C23H23ClN5O8PS/c1-12(14-4-2-3-13(7-14)8-25)27-18-15-5-6-29(22(15)28-21(24)16(18)9-26)23-20(31)19(30)17(37-23)10-39(35,36)11-38(32,33)34/h2-7,12,17,19-20,23,30-31H,10-11H2,1H3,(H,27,28)(H2,32,33,34)/t12-,17-,19-,20-,23-/m1/s1 |
| InChIKey | ZBTPWNWYLGOKEJ-FIAVLUJFSA-N |
| XLogP | 1.78 |
| TPSA | 218.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.96 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|