C14H15ClFN4O7PS — CID 159003631
[(2S,3R,4S,5R)-5-(4-amino-6-chloro-5-cyanopyrrolo[2,3-b]pyridin-1-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid (PubChem CID 159003631) has the molecular formula C14H15ClFN4O7PS and a molecular weight of 468.79 g/mol. Its IUPAC name is [(2S,3R,4S,5R)-5-(4-amino-6-chloro-5-cyanopyrrolo[2,3-b]pyridin-1-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid.
| Compound Name | [(2S,3R,4S,5R)-5-(4-amino-6-chloro-5-cyanopyrrolo[2,3-b]pyridin-1-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid |
|---|---|
| PubChem CID | 159003631 |
| Molecular Formula | C14H15ClFN4O7PS |
| Molecular Weight | 468.79 g/mol |
| Exact Mass | 468.01 |
| IUPAC Name | [(2S,3R,4S,5R)-5-(4-amino-6-chloro-5-cyanopyrrolo[2,3-b]pyridin-1-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid |
| SMILES | N#Cc1c(Cl)nc2c(ccn2[C@@H]2O[C@H](CS(=O)(=O)CP(=O)(O)O)[C@@H](O)[C@@H]2F)c1N |
| InChI | InChI=1S/C14H15ClFN4O7PS/c15-12-7(3-17)10(18)6-1-2-20(13(6)19-12)14-9(16)11(21)8(27-14)4-29(25,26)5-28(22,23)24/h1-2,8-9,11,14,21H,4-5H2,(H2,18,19)(H2,22,23,24)/t8-,9+,11-,14-/m1/s1 |
| InChIKey | JRQMSXRVYOLHDB-SZRLZVLASA-N |
| XLogP | 0.29 |
| TPSA | 188.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.79 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|