C11H18N3O9PS — CID 25198412
2-[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]ethylsulfonylmethylphosphonic acid (PubChem CID 25198412) has the molecular formula C11H18N3O9PS and a molecular weight of 399.32 g/mol. Its IUPAC name is 2-[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]ethylsulfonylmethylphosphonic acid.
| Compound Name | 2-[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]ethylsulfonylmethylphosphonic acid |
|---|---|
| PubChem CID | 25198412 |
| Molecular Formula | C11H18N3O9PS |
| Molecular Weight | 399.32 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | 2-[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]ethylsulfonylmethylphosphonic acid |
| SMILES | Nc1ccn([C@@H]2O[C@H](CCS(=O)(=O)CP(=O)(O)O)[C@@H](O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C11H18N3O9PS/c12-7-1-3-14(11(17)13-7)10-9(16)8(15)6(23-10)2-4-25(21,22)5-24(18,19)20/h1,3,6,8-10,15-16H,2,4-5H2,(H2,12,13,17)(H2,18,19,20)/t6-,8-,9-,10-/m1/s1 |
| InChIKey | BAOUZYAONBQMRS-PEBGCTIMSA-N |
| XLogP | -2.62 |
| TPSA | 202.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.32 |
| LogP ≤ 5 | -2.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|