C19H22ClF2N4O8PS — CID 159515963
[(2S,3S,4R,5R)-5-[6-chloro-5-cyano-4-[[(1S)-3,3-difluorocyclopentyl]amino]pyrrolo[2,3-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid (PubChem CID 159515963) has the molecular formula C19H22ClF2N4O8PS and a molecular weight of 570.90 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-5-[6-chloro-5-cyano-4-[[(1S)-3,3-difluorocyclopentyl]amino]pyrrolo[2,3-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid.
| Compound Name | [(2S,3S,4R,5R)-5-[6-chloro-5-cyano-4-[[(1S)-3,3-difluorocyclopentyl]amino]pyrrolo[2,3-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid |
|---|---|
| PubChem CID | 159515963 |
| Molecular Formula | C19H22ClF2N4O8PS |
| Molecular Weight | 570.90 g/mol |
| Exact Mass | 570.06 |
| IUPAC Name | [(2S,3S,4R,5R)-5-[6-chloro-5-cyano-4-[[(1S)-3,3-difluorocyclopentyl]amino]pyrrolo[2,3-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid |
| SMILES | N#Cc1c(Cl)nc2c(ccn2[C@@H]2O[C@H](CS(=O)(=O)CP(=O)(O)O)[C@@H](O)[C@H]2O)c1N[C@H]1CCC(F)(F)C1 |
| InChI | InChI=1S/C19H22ClF2N4O8PS/c20-16-11(6-23)13(24-9-1-3-19(21,22)5-9)10-2-4-26(17(10)25-16)18-15(28)14(27)12(34-18)7-36(32,33)8-35(29,30)31/h2,4,9,12,14-15,18,27-28H,1,3,5,7-8H2,(H,24,25)(H2,29,30,31)/t9-,12+,14+,15+,18+/m0/s1 |
| InChIKey | MBEVTBOSNMZGNT-YBGGAFRISA-N |
| XLogP | 1.33 |
| TPSA | 195.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.90 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|