C24H35ClN5O6P — CID 156682137
3-[(2R,3R,5R)-5-[2-chloro-6-[[(3S,5R)-3,5-dimethyl-1-adamantyl]amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]propylphosphonic acid (PubChem CID 156682137) has the molecular formula C24H35ClN5O6P and a molecular weight of 556.00 g/mol. Its IUPAC name is 3-[(2R,3R,5R)-5-[2-chloro-6-[[(3S,5R)-3,5-dimethyl-1-adamantyl]amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]propylphosphonic acid.
| Compound Name | 3-[(2R,3R,5R)-5-[2-chloro-6-[[(3S,5R)-3,5-dimethyl-1-adamantyl]amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]propylphosphonic acid |
|---|---|
| PubChem CID | 156682137 |
| Molecular Formula | C24H35ClN5O6P |
| Molecular Weight | 556.00 g/mol |
| Exact Mass | 555.20 |
| IUPAC Name | 3-[(2R,3R,5R)-5-[2-chloro-6-[[(3S,5R)-3,5-dimethyl-1-adamantyl]amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]propylphosphonic acid |
| SMILES | C[C@]12CC3CC(Nc4nc(Cl)nc5c4ncn5[C@@H]4O[C@H](CCCP(=O)(O)O)[C@H](O)C4O)(C1)C[C@@](C)(C3)C2 |
| InChI | InChI=1S/C24H35ClN5O6P/c1-22-6-13-7-23(2,9-22)11-24(8-13,10-22)29-18-15-19(28-21(25)27-18)30(12-26-15)20-17(32)16(31)14(36-20)4-3-5-37(33,34)35/h12-14,16-17,20,31-32H,3-11H2,1-2H3,(H,27,28,29)(H2,33,34,35)/t13?,14-,16+,17?,20-,22-,23+,24?/m1/s1 |
| InChIKey | KKVWUUTXINHSKP-XPSKEIDASA-N |
| XLogP | 3.22 |
| TPSA | 162.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.00 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|