C24H32ClN5O8S — CID 153461322
2-[[(2R,3R,5R)-5-[2-chloro-6-[[(3S,5R)-3,5-dimethyl-1-adamantyl]amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-2-oxoethanesulfonic acid (PubChem CID 153461322) has the molecular formula C24H32ClN5O8S and a molecular weight of 586.07 g/mol. Its IUPAC name is 2-[[(2R,3R,5R)-5-[2-chloro-6-[[(3S,5R)-3,5-dimethyl-1-adamantyl]amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-2-oxoethanesulfonic acid.
| Compound Name | 2-[[(2R,3R,5R)-5-[2-chloro-6-[[(3S,5R)-3,5-dimethyl-1-adamantyl]amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 153461322 |
| Molecular Formula | C24H32ClN5O8S |
| Molecular Weight | 586.07 g/mol |
| Exact Mass | 585.17 |
| IUPAC Name | 2-[[(2R,3R,5R)-5-[2-chloro-6-[[(3S,5R)-3,5-dimethyl-1-adamantyl]amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-2-oxoethanesulfonic acid |
| SMILES | C[C@]12CC3CC(Nc4nc(Cl)nc5c4ncn5[C@@H]4O[C@H](COC(=O)CS(=O)(=O)O)[C@H](O)C4O)(C1)C[C@@](C)(C3)C2 |
| InChI | InChI=1S/C24H32ClN5O8S/c1-22-3-12-4-23(2,8-22)10-24(5-12,9-22)29-18-15-19(28-21(25)27-18)30(11-26-15)20-17(33)16(32)13(38-20)6-37-14(31)7-39(34,35)36/h11-13,16-17,20,32-33H,3-10H2,1-2H3,(H,27,28,29)(H,34,35,36)/t12?,13-,16+,17?,20-,22-,23+,24?/m1/s1 |
| InChIKey | QPXPBHQALIMAEB-WCVZKJLISA-N |
| XLogP | 1.69 |
| TPSA | 185.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.07 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|