C20H23Cl2N5O4 — CID 142587060
5-[6-chloro-4-[(2-chlorophenyl)methylamino]pyrazolo[3,4-d]pyrimidin-1-yl]oxolane-2-carbaldehyde;propane-2,2-diol (PubChem CID 142587060) has the molecular formula C20H23Cl2N5O4 and a molecular weight of 468.34 g/mol. Its IUPAC name is 5-[6-chloro-4-[(2-chlorophenyl)methylamino]pyrazolo[3,4-d]pyrimidin-1-yl]oxolane-2-carbaldehyde;propane-2,2-diol.
| Compound Name | 5-[6-chloro-4-[(2-chlorophenyl)methylamino]pyrazolo[3,4-d]pyrimidin-1-yl]oxolane-2-carbaldehyde;propane-2,2-diol |
|---|---|
| PubChem CID | 142587060 |
| Molecular Formula | C20H23Cl2N5O4 |
| Molecular Weight | 468.34 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | 5-[6-chloro-4-[(2-chlorophenyl)methylamino]pyrazolo[3,4-d]pyrimidin-1-yl]oxolane-2-carbaldehyde;propane-2,2-diol |
| SMILES | CC(C)(O)O.O=CC1CCC(n2ncc3c(NCc4ccccc4Cl)nc(Cl)nc32)O1 |
| InChI | InChI=1S/C17H15Cl2N5O2.C3H8O2/c18-13-4-2-1-3-10(13)7-20-15-12-8-21-24(16(12)23-17(19)22-15)14-6-5-11(9-25)26-14;1-3(2,4)5/h1-4,8-9,11,14H,5-7H2,(H,20,22,23);4-5H,1-2H3 |
| InChIKey | WAFGMKULZVTBLM-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 122.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.34 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|