C18H26ClN6O7P — CID 174163585
[(2R,3S,4R,5R)-5-[6-chloro-4-(2,8-diazaspiro[3.5]nonan-2-yl)pyrazolo[5,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid (PubChem CID 174163585) has the molecular formula C18H26ClN6O7P and a molecular weight of 504.87 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[6-chloro-4-(2,8-diazaspiro[3.5]nonan-2-yl)pyrazolo[5,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid.
| Compound Name | [(2R,3S,4R,5R)-5-[6-chloro-4-(2,8-diazaspiro[3.5]nonan-2-yl)pyrazolo[5,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid |
|---|---|
| PubChem CID | 174163585 |
| Molecular Formula | C18H26ClN6O7P |
| Molecular Weight | 504.87 g/mol |
| Exact Mass | 504.13 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[6-chloro-4-(2,8-diazaspiro[3.5]nonan-2-yl)pyrazolo[5,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid |
| SMILES | O=P(O)(O)COC[C@H]1O[C@@H](n2ncc3c(N4CC5(CCCNC5)C4)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H26ClN6O7P/c19-17-22-14(24-7-18(8-24)2-1-3-20-6-18)10-4-21-25(15(10)23-17)16-13(27)12(26)11(32-16)5-31-9-33(28,29)30/h4,11-13,16,20,26-27H,1-3,5-9H2,(H2,28,29,30)/t11-,12-,13-,16-/m1/s1 |
| InChIKey | SOPNCOHNIMCBPW-BRXULGCHSA-N |
| XLogP | -0.56 |
| TPSA | 175.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.87 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|