C16H23ClN5O8PS — CID 147680517
2-[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopropylmethylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]ethylsulfonylmethylphosphonic acid (PubChem CID 147680517) has the molecular formula C16H23ClN5O8PS and a molecular weight of 511.88 g/mol. Its IUPAC name is 2-[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopropylmethylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]ethylsulfonylmethylphosphonic acid.
| Compound Name | 2-[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopropylmethylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]ethylsulfonylmethylphosphonic acid |
|---|---|
| PubChem CID | 147680517 |
| Molecular Formula | C16H23ClN5O8PS |
| Molecular Weight | 511.88 g/mol |
| Exact Mass | 511.07 |
| IUPAC Name | 2-[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopropylmethylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]ethylsulfonylmethylphosphonic acid |
| SMILES | O=P(O)(O)CS(=O)(=O)CC[C@H]1O[C@@H](n2ncc3c(NCC4CC4)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H23ClN5O8PS/c17-16-20-13(18-5-8-1-2-8)9-6-19-22(14(9)21-16)15-12(24)11(23)10(30-15)3-4-32(28,29)7-31(25,26)27/h6,8,10-12,15,23-24H,1-5,7H2,(H,18,20,21)(H2,25,26,27)/t10-,11-,12-,15-/m1/s1 |
| InChIKey | GPAKHDTZTXKBIU-RTWAVKEYSA-N |
| XLogP | -0.14 |
| TPSA | 196.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.88 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|