C20H23ClN5O8PS — CID 155254556
[(2S,3S,4R,5R)-5-[6-chloro-4-[[(1R)-2,3-dihydro-1H-inden-1-yl]amino]pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid (PubChem CID 155254556) has the molecular formula C20H23ClN5O8PS and a molecular weight of 559.93 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-5-[6-chloro-4-[[(1R)-2,3-dihydro-1H-inden-1-yl]amino]pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid.
| Compound Name | [(2S,3S,4R,5R)-5-[6-chloro-4-[[(1R)-2,3-dihydro-1H-inden-1-yl]amino]pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid |
|---|---|
| PubChem CID | 155254556 |
| Molecular Formula | C20H23ClN5O8PS |
| Molecular Weight | 559.93 g/mol |
| Exact Mass | 559.07 |
| IUPAC Name | [(2S,3S,4R,5R)-5-[6-chloro-4-[[(1R)-2,3-dihydro-1H-inden-1-yl]amino]pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid |
| SMILES | O=P(O)(O)CS(=O)(=O)C[C@H]1O[C@@H](n2ncc3c(N[C@@H]4CCc5ccccc54)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H23ClN5O8PS/c21-20-24-17(23-13-6-5-10-3-1-2-4-11(10)13)12-7-22-26(18(12)25-20)19-16(28)15(27)14(34-19)8-36(32,33)9-35(29,30)31/h1-4,7,13-16,19,27-28H,5-6,8-9H2,(H,23,24,25)(H2,29,30,31)/t13-,14-,15-,16-,19-/m1/s1 |
| InChIKey | SICWWGMGGUSIMG-DINLJIAVSA-N |
| XLogP | 0.75 |
| TPSA | 196.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.93 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|