C22H28ClN5O9P2 — CID 146496644
[[(2R,3S,4R,5R)-5-[6-chloro-4-[2,3-dihydro-1H-inden-1-yl(methyl)amino]pyrazolo[5,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-methoxyphosphoryl]methylphosphonic acid (PubChem CID 146496644) has the molecular formula C22H28ClN5O9P2 and a molecular weight of 603.89 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-[6-chloro-4-[2,3-dihydro-1H-inden-1-yl(methyl)amino]pyrazolo[5,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-methoxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2R,3S,4R,5R)-5-[6-chloro-4-[2,3-dihydro-1H-inden-1-yl(methyl)amino]pyrazolo[5,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-methoxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 146496644 |
| Molecular Formula | C22H28ClN5O9P2 |
| Molecular Weight | 603.89 g/mol |
| Exact Mass | 603.11 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-[6-chloro-4-[2,3-dihydro-1H-inden-1-yl(methyl)amino]pyrazolo[5,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-methoxyphosphoryl]methylphosphonic acid |
| SMILES | COP(=O)(CP(=O)(O)O)OC[C@H]1O[C@@H](n2ncc3c(N(C)C4CCc5ccccc54)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H28ClN5O9P2/c1-27(15-8-7-12-5-3-4-6-13(12)15)19-14-9-24-28(20(14)26-22(23)25-19)21-18(30)17(29)16(37-21)10-36-39(34,35-2)11-38(31,32)33/h3-6,9,15-18,21,29-30H,7-8,10-11H2,1-2H3,(H2,31,32,33)/t15?,16-,17-,18-,21-,39?/m1/s1 |
| InChIKey | WHRBEHDGFDMYRD-WLXHGYANSA-N |
| XLogP | 2.21 |
| TPSA | 189.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.89 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|