C21H24ClN6O8P — CID 142587065
[2-[[(2R,3S,4R,5R)-5-[5-chloro-7-[[(1S)-2,3-dihydro-1H-inden-1-yl]-methylamino]triazolo[4,5-d]pyrimidin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-2-oxoethyl]phosphonic acid (PubChem CID 142587065) has the molecular formula C21H24ClN6O8P and a molecular weight of 554.88 g/mol. Its IUPAC name is [2-[[(2R,3S,4R,5R)-5-[5-chloro-7-[[(1S)-2,3-dihydro-1H-inden-1-yl]-methylamino]triazolo[4,5-d]pyrimidin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-2-oxoethyl]phosphonic acid.
| Compound Name | [2-[[(2R,3S,4R,5R)-5-[5-chloro-7-[[(1S)-2,3-dihydro-1H-inden-1-yl]-methylamino]triazolo[4,5-d]pyrimidin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-2-oxoethyl]phosphonic acid |
|---|---|
| PubChem CID | 142587065 |
| Molecular Formula | C21H24ClN6O8P |
| Molecular Weight | 554.88 g/mol |
| Exact Mass | 554.11 |
| IUPAC Name | [2-[[(2R,3S,4R,5R)-5-[5-chloro-7-[[(1S)-2,3-dihydro-1H-inden-1-yl]-methylamino]triazolo[4,5-d]pyrimidin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-2-oxoethyl]phosphonic acid |
| SMILES | CN(c1nc(Cl)nc2c1nnn2[C@@H]1O[C@H](COC(=O)CP(=O)(O)O)[C@@H](O)[C@H]1O)[C@H]1CCc2ccccc21 |
| InChI | InChI=1S/C21H24ClN6O8P/c1-27(12-7-6-10-4-2-3-5-11(10)12)18-15-19(24-21(22)23-18)28(26-25-15)20-17(31)16(30)13(36-20)8-35-14(29)9-37(32,33)34/h2-5,12-13,16-17,20,30-31H,6-9H2,1H3,(H2,32,33,34)/t12-,13+,16+,17+,20+/m0/s1 |
| InChIKey | BPVKTYWBOVDMBP-JDLZUTDUSA-N |
| XLogP | 0.34 |
| TPSA | 193.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.88 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|