C20H25ClN6O8P2 — CID 146496806
[[(1R,2R,3S)-4-[5-chloro-7-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]triazolo[4,5-d]pyrimidin-3-yl]-2,3-dihydroxycyclopentyl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 146496806) has the molecular formula C20H25ClN6O8P2 and a molecular weight of 574.86 g/mol. Its IUPAC name is [[(1R,2R,3S)-4-[5-chloro-7-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]triazolo[4,5-d]pyrimidin-3-yl]-2,3-dihydroxycyclopentyl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(1R,2R,3S)-4-[5-chloro-7-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]triazolo[4,5-d]pyrimidin-3-yl]-2,3-dihydroxycyclopentyl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 146496806 |
| Molecular Formula | C20H25ClN6O8P2 |
| Molecular Weight | 574.86 g/mol |
| Exact Mass | 574.09 |
| IUPAC Name | [[(1R,2R,3S)-4-[5-chloro-7-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]triazolo[4,5-d]pyrimidin-3-yl]-2,3-dihydroxycyclopentyl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | O=P(O)(O)CP(=O)(O)OC[C@H]1CC(n2nnc3c(N[C@H]4CCc5ccccc54)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H25ClN6O8P2/c21-20-23-18(22-13-6-5-10-3-1-2-4-12(10)13)15-19(24-20)27(26-25-15)14-7-11(16(28)17(14)29)8-35-37(33,34)9-36(30,31)32/h1-4,11,13-14,16-17,28-29H,5-9H2,(H,33,34)(H,22,23,24)(H2,30,31,32)/t11-,13+,14?,16-,17+/m1/s1 |
| InChIKey | GGZDFQHZRFNAEU-VNHGCOAGSA-N |
| XLogP | 1.59 |
| TPSA | 213.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.86 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|