C19H25Cl2N7O9P2S — CID 153467335
[[(1S,2R,3S,4R)-4-[5-chloro-7-[(2-chlorophenyl)methylamino]triazolo[4,5-d]pyrimidin-3-yl]-3-hydroxy-2-(methanesulfonamido)cyclopentyl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 153467335) has the molecular formula C19H25Cl2N7O9P2S and a molecular weight of 660.37 g/mol. Its IUPAC name is [[(1S,2R,3S,4R)-4-[5-chloro-7-[(2-chlorophenyl)methylamino]triazolo[4,5-d]pyrimidin-3-yl]-3-hydroxy-2-(methanesulfonamido)cyclopentyl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(1S,2R,3S,4R)-4-[5-chloro-7-[(2-chlorophenyl)methylamino]triazolo[4,5-d]pyrimidin-3-yl]-3-hydroxy-2-(methanesulfonamido)cyclopentyl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 153467335 |
| Molecular Formula | C19H25Cl2N7O9P2S |
| Molecular Weight | 660.37 g/mol |
| Exact Mass | 659.03 |
| IUPAC Name | [[(1S,2R,3S,4R)-4-[5-chloro-7-[(2-chlorophenyl)methylamino]triazolo[4,5-d]pyrimidin-3-yl]-3-hydroxy-2-(methanesulfonamido)cyclopentyl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | CS(=O)(=O)N[C@@H]1[C@@H](COP(=O)(O)CP(=O)(O)O)C[C@@H](n2nnc3c(NCc4ccccc4Cl)nc(Cl)nc32)[C@@H]1O |
| InChI | InChI=1S/C19H25Cl2N7O9P2S/c1-40(35,36)26-14-11(8-37-39(33,34)9-38(30,31)32)6-13(16(14)29)28-18-15(25-27-28)17(23-19(21)24-18)22-7-10-4-2-3-5-12(10)20/h2-5,11,13-14,16,26,29H,6-9H2,1H3,(H,33,34)(H,22,23,24)(H2,30,31,32)/t11-,13-,14-,16+/m1/s1 |
| InChIKey | ASOMRIZOYMUSCV-MEWXFMAXSA-N |
| XLogP | 1.32 |
| TPSA | 238.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.37 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|