C20H24Cl2N6O9P2 — CID 142470789
[[(2R,3S,4R,5R)-5-[5-chloro-7-[(2-chlorophenyl)methylamino]triazolo[4,5-d]pyrimidin-3-yl]-3-cyclopropyl-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 142470789) has the molecular formula C20H24Cl2N6O9P2 and a molecular weight of 625.30 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-[5-chloro-7-[(2-chlorophenyl)methylamino]triazolo[4,5-d]pyrimidin-3-yl]-3-cyclopropyl-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2R,3S,4R,5R)-5-[5-chloro-7-[(2-chlorophenyl)methylamino]triazolo[4,5-d]pyrimidin-3-yl]-3-cyclopropyl-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 142470789 |
| Molecular Formula | C20H24Cl2N6O9P2 |
| Molecular Weight | 625.30 g/mol |
| Exact Mass | 624.05 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-[5-chloro-7-[(2-chlorophenyl)methylamino]triazolo[4,5-d]pyrimidin-3-yl]-3-cyclopropyl-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | O=P(O)(O)CP(=O)(O)OC[C@H]1O[C@@H](n2nnc3c(NCc4ccccc4Cl)nc(Cl)nc32)[C@H](O)[C@@]1(O)C1CC1 |
| InChI | InChI=1S/C20H24Cl2N6O9P2/c21-12-4-2-1-3-10(12)7-23-16-14-17(25-19(22)24-16)28(27-26-14)18-15(29)20(30,11-5-6-11)13(37-18)8-36-39(34,35)9-38(31,32)33/h1-4,11,13,15,18,29-30H,5-9H2,(H,34,35)(H,23,24,25)(H2,31,32,33)/t13-,15+,18-,20-/m1/s1 |
| InChIKey | OHEDBVDYWLNCEA-UHWHQUHESA-N |
| XLogP | 1.88 |
| TPSA | 222.27 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|