C19H24Cl2N6O8P2 — CID 146496740
[[(1R,2R,3S,4R)-4-[5-chloro-7-[(3-chlorophenyl)methyl-methylamino]triazolo[4,5-d]pyrimidin-3-yl]-2,3-dihydroxycyclopentyl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 146496740) has the molecular formula C19H24Cl2N6O8P2 and a molecular weight of 597.29 g/mol. Its IUPAC name is [[(1R,2R,3S,4R)-4-[5-chloro-7-[(3-chlorophenyl)methyl-methylamino]triazolo[4,5-d]pyrimidin-3-yl]-2,3-dihydroxycyclopentyl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(1R,2R,3S,4R)-4-[5-chloro-7-[(3-chlorophenyl)methyl-methylamino]triazolo[4,5-d]pyrimidin-3-yl]-2,3-dihydroxycyclopentyl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 146496740 |
| Molecular Formula | C19H24Cl2N6O8P2 |
| Molecular Weight | 597.29 g/mol |
| Exact Mass | 596.05 |
| IUPAC Name | [[(1R,2R,3S,4R)-4-[5-chloro-7-[(3-chlorophenyl)methyl-methylamino]triazolo[4,5-d]pyrimidin-3-yl]-2,3-dihydroxycyclopentyl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | CN(Cc1cccc(Cl)c1)c1nc(Cl)nc2c1nnn2[C@@H]1C[C@H](COP(=O)(O)CP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C19H24Cl2N6O8P2/c1-26(7-10-3-2-4-12(20)5-10)17-14-18(23-19(21)22-17)27(25-24-14)13-6-11(15(28)16(13)29)8-35-37(33,34)9-36(30,31)32/h2-5,11,13,15-16,28-29H,6-9H2,1H3,(H,33,34)(H2,30,31,32)/t11-,13-,15-,16+/m1/s1 |
| InChIKey | BTNGVMVYZIGGKK-CUBALJKWSA-N |
| XLogP | 1.78 |
| TPSA | 204.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.29 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|