C21H26ClN5O8P2 — CID 146496847
[[(2R,3S,5R)-5-[6-chloro-4-[[(1S)-2,3-dihydro-1H-inden-1-yl]-methylamino]pyrazolo[5,4-d]pyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 146496847) has the molecular formula C21H26ClN5O8P2 and a molecular weight of 573.87 g/mol. Its IUPAC name is [[(2R,3S,5R)-5-[6-chloro-4-[[(1S)-2,3-dihydro-1H-inden-1-yl]-methylamino]pyrazolo[5,4-d]pyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2R,3S,5R)-5-[6-chloro-4-[[(1S)-2,3-dihydro-1H-inden-1-yl]-methylamino]pyrazolo[5,4-d]pyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 146496847 |
| Molecular Formula | C21H26ClN5O8P2 |
| Molecular Weight | 573.87 g/mol |
| Exact Mass | 573.09 |
| IUPAC Name | [[(2R,3S,5R)-5-[6-chloro-4-[[(1S)-2,3-dihydro-1H-inden-1-yl]-methylamino]pyrazolo[5,4-d]pyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | CN(c1nc(Cl)nc2c1cnn2[C@H]1C[C@H](O)[C@@H](COP(=O)(O)CP(=O)(O)O)O1)[C@H]1CCc2ccccc21 |
| InChI | InChI=1S/C21H26ClN5O8P2/c1-26(15-7-6-12-4-2-3-5-13(12)15)19-14-9-23-27(20(14)25-21(22)24-19)18-8-16(28)17(35-18)10-34-37(32,33)11-36(29,30)31/h2-5,9,15-18,28H,6-8,10-11H2,1H3,(H,32,33)(H2,29,30,31)/t15-,16-,17+,18+/m0/s1 |
| InChIKey | MQCPKXVOQDCZBU-WNRNVDISSA-N |
| XLogP | 2.59 |
| TPSA | 180.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.87 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|