C22H27ClN4O9P2 — CID 164776436
[[(2R,3R,5R)-5-[6-chloro-4-[[(1S)-2,3-dihydro-1H-inden-1-yl]-methylamino]pyrazolo[5,4-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 164776436) has the molecular formula C22H27ClN4O9P2 and a molecular weight of 588.88 g/mol. Its IUPAC name is [[(2R,3R,5R)-5-[6-chloro-4-[[(1S)-2,3-dihydro-1H-inden-1-yl]-methylamino]pyrazolo[5,4-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2R,3R,5R)-5-[6-chloro-4-[[(1S)-2,3-dihydro-1H-inden-1-yl]-methylamino]pyrazolo[5,4-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 164776436 |
| Molecular Formula | C22H27ClN4O9P2 |
| Molecular Weight | 588.88 g/mol |
| Exact Mass | 588.09 |
| IUPAC Name | [[(2R,3R,5R)-5-[6-chloro-4-[[(1S)-2,3-dihydro-1H-inden-1-yl]-methylamino]pyrazolo[5,4-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | CN(c1cc(Cl)nc2c1cnn2[C@@H]1O[C@H](COP(=O)(O)CP(=O)(O)O)[C@H](O)C1O)[C@H]1CCc2ccccc21 |
| InChI | InChI=1S/C22H27ClN4O9P2/c1-26(15-7-6-12-4-2-3-5-13(12)15)16-8-18(23)25-21-14(16)9-24-27(21)22-20(29)19(28)17(36-22)10-35-38(33,34)11-37(30,31)32/h2-5,8-9,15,17,19-20,22,28-29H,6-7,10-11H2,1H3,(H,33,34)(H2,30,31,32)/t15-,17+,19-,20?,22+/m0/s1 |
| InChIKey | KFRNYNAWDJQJPO-ORKZQWPWSA-N |
| XLogP | 2.16 |
| TPSA | 187.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.88 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|