C20H24ClN5O9P2 — CID 155222838
[[(2R,3S,4R,5S)-5-[2-chloro-4-(2,3-dihydro-1H-inden-1-ylamino)imidazo[2,1-f][1,2,4]triazin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 155222838) has the molecular formula C20H24ClN5O9P2 and a molecular weight of 575.84 g/mol. Its IUPAC name is [[(2R,3S,4R,5S)-5-[2-chloro-4-(2,3-dihydro-1H-inden-1-ylamino)imidazo[2,1-f][1,2,4]triazin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2R,3S,4R,5S)-5-[2-chloro-4-(2,3-dihydro-1H-inden-1-ylamino)imidazo[2,1-f][1,2,4]triazin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 155222838 |
| Molecular Formula | C20H24ClN5O9P2 |
| Molecular Weight | 575.84 g/mol |
| Exact Mass | 575.07 |
| IUPAC Name | [[(2R,3S,4R,5S)-5-[2-chloro-4-(2,3-dihydro-1H-inden-1-ylamino)imidazo[2,1-f][1,2,4]triazin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | O=P(O)(O)CP(=O)(O)OC[C@H]1O[C@@H](c2cnc3c(NC4CCc5ccccc54)nc(Cl)nn23)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H24ClN5O9P2/c21-20-24-18(23-12-6-5-10-3-1-2-4-11(10)12)19-22-7-13(26(19)25-20)17-16(28)15(27)14(35-17)8-34-37(32,33)9-36(29,30)31/h1-4,7,12,14-17,27-28H,5-6,8-9H2,(H,32,33)(H,23,24,25)(H2,29,30,31)/t12?,14-,15-,16-,17+/m1/s1 |
| InChIKey | WNNFWJAHFBJBIA-LJWMNGLYSA-N |
| XLogP | 1.38 |
| TPSA | 208.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.84 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|