C17H23ClN4O9P2 — CID 167337556
[[(2R,3S,4R,5S)-5-[8-(3-azabicyclo[3.1.0]hexan-3-yl)-6-chloroimidazo[1,2-b]pyridazin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 167337556) has the molecular formula C17H23ClN4O9P2 and a molecular weight of 524.79 g/mol. Its IUPAC name is [[(2R,3S,4R,5S)-5-[8-(3-azabicyclo[3.1.0]hexan-3-yl)-6-chloroimidazo[1,2-b]pyridazin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2R,3S,4R,5S)-5-[8-(3-azabicyclo[3.1.0]hexan-3-yl)-6-chloroimidazo[1,2-b]pyridazin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 167337556 |
| Molecular Formula | C17H23ClN4O9P2 |
| Molecular Weight | 524.79 g/mol |
| Exact Mass | 524.06 |
| IUPAC Name | [[(2R,3S,4R,5S)-5-[8-(3-azabicyclo[3.1.0]hexan-3-yl)-6-chloroimidazo[1,2-b]pyridazin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | O=P(O)(O)CP(=O)(O)OC[C@H]1O[C@@H](c2cnc3c(N4CC5CC5C4)cc(Cl)nn23)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H23ClN4O9P2/c18-13-2-10(21-4-8-1-9(8)5-21)17-19-3-11(22(17)20-13)16-15(24)14(23)12(31-16)6-30-33(28,29)7-32(25,26)27/h2-3,8-9,12,14-16,23-24H,1,4-7H2,(H,28,29)(H2,25,26,27)/t8?,9?,12-,14-,15-,16+/m1/s1 |
| InChIKey | WVJOMCRPWRBTOX-HYXCAOCXSA-N |
| XLogP | 0.34 |
| TPSA | 187.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.79 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|