C19H23Cl2N5O9P2 — CID 164804970
[[5-[2-chloro-4-[[(1S)-1-(4-chlorophenyl)ethyl]amino]imidazo[2,1-f][1,2,4]triazin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 164804970) has the molecular formula C19H23Cl2N5O9P2 and a molecular weight of 598.27 g/mol. Its IUPAC name is [[5-[2-chloro-4-[[(1S)-1-(4-chlorophenyl)ethyl]amino]imidazo[2,1-f][1,2,4]triazin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[5-[2-chloro-4-[[(1S)-1-(4-chlorophenyl)ethyl]amino]imidazo[2,1-f][1,2,4]triazin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 164804970 |
| Molecular Formula | C19H23Cl2N5O9P2 |
| Molecular Weight | 598.27 g/mol |
| Exact Mass | 597.03 |
| IUPAC Name | [[5-[2-chloro-4-[[(1S)-1-(4-chlorophenyl)ethyl]amino]imidazo[2,1-f][1,2,4]triazin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | C[C@H](Nc1nc(Cl)nn2c(C3OC(COP(=O)(O)CP(=O)(O)O)C(O)C3O)cnc12)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H23Cl2N5O9P2/c1-9(10-2-4-11(20)5-3-10)23-17-18-22-6-12(26(18)25-19(21)24-17)16-15(28)14(27)13(35-16)7-34-37(32,33)8-36(29,30)31/h2-6,9,13-16,27-28H,7-8H2,1H3,(H,32,33)(H,23,24,25)(H2,29,30,31)/t9-,13?,14?,15?,16?/m0/s1 |
| InChIKey | VYJNHLUCFQKLGF-QSURDESESA-N |
| XLogP | 2.10 |
| TPSA | 208.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.27 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|