C19H23ClFN5O7P2 — CID 167132892
[[(2S,5R)-5-[2-chloro-4-[[(1S)-1-(4-fluorophenyl)ethyl]amino]imidazo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 167132892) has the molecular formula C19H23ClFN5O7P2 and a molecular weight of 549.82 g/mol. Its IUPAC name is [[(2S,5R)-5-[2-chloro-4-[[(1S)-1-(4-fluorophenyl)ethyl]amino]imidazo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2S,5R)-5-[2-chloro-4-[[(1S)-1-(4-fluorophenyl)ethyl]amino]imidazo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 167132892 |
| Molecular Formula | C19H23ClFN5O7P2 |
| Molecular Weight | 549.82 g/mol |
| Exact Mass | 549.07 |
| IUPAC Name | [[(2S,5R)-5-[2-chloro-4-[[(1S)-1-(4-fluorophenyl)ethyl]amino]imidazo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | C[C@H](Nc1nc(Cl)nn2c([C@H]3CC[C@@H](COP(=O)(O)CP(=O)(O)O)O3)cnc12)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H23ClFN5O7P2/c1-11(12-2-4-13(21)5-3-12)23-17-18-22-8-15(26(18)25-19(20)24-17)16-7-6-14(33-16)9-32-35(30,31)10-34(27,28)29/h2-5,8,11,14,16H,6-7,9-10H2,1H3,(H,30,31)(H,23,24,25)(H2,27,28,29)/t11-,14-,16+/m0/s1 |
| InChIKey | MYXHKCBLVRILRU-HZUKXOBISA-N |
| XLogP | 3.65 |
| TPSA | 168.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.82 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|