C18H26ClN4O5P — CID 155579925
1-[[5-[2-chloro-4-(cyclopentylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methoxy]ethylphosphonic acid (PubChem CID 155579925) has the molecular formula C18H26ClN4O5P and a molecular weight of 444.86 g/mol. Its IUPAC name is 1-[[5-[2-chloro-4-(cyclopentylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methoxy]ethylphosphonic acid.
| Compound Name | 1-[[5-[2-chloro-4-(cyclopentylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methoxy]ethylphosphonic acid |
|---|---|
| PubChem CID | 155579925 |
| Molecular Formula | C18H26ClN4O5P |
| Molecular Weight | 444.86 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 1-[[5-[2-chloro-4-(cyclopentylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methoxy]ethylphosphonic acid |
| SMILES | CC(OCC1CCC(c2ccc3c(NC4CCCC4)nc(Cl)nn23)O1)P(=O)(O)O |
| InChI | InChI=1S/C18H26ClN4O5P/c1-11(29(24,25)26)27-10-13-6-9-16(28-13)14-7-8-15-17(20-12-4-2-3-5-12)21-18(19)22-23(14)15/h7-8,11-13,16H,2-6,9-10H2,1H3,(H,20,21,22)(H2,24,25,26) |
| InChIKey | MDICFRBDJUXSPF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 118.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.86 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|