C19H30N5O7P — CID 159855228
1-[[(2R,3S,4R,5R)-5-[4-(cyclopentylamino)-6-ethylpyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]ethylphosphonic acid (PubChem CID 159855228) has the molecular formula C19H30N5O7P and a molecular weight of 471.45 g/mol. Its IUPAC name is 1-[[(2R,3S,4R,5R)-5-[4-(cyclopentylamino)-6-ethylpyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]ethylphosphonic acid.
| Compound Name | 1-[[(2R,3S,4R,5R)-5-[4-(cyclopentylamino)-6-ethylpyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]ethylphosphonic acid |
|---|---|
| PubChem CID | 159855228 |
| Molecular Formula | C19H30N5O7P |
| Molecular Weight | 471.45 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | 1-[[(2R,3S,4R,5R)-5-[4-(cyclopentylamino)-6-ethylpyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]ethylphosphonic acid |
| SMILES | CCc1nc(NC2CCCC2)c2cnn([C@@H]3O[C@H](COC(C)P(=O)(O)O)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C19H30N5O7P/c1-3-14-22-17(21-11-6-4-5-7-11)12-8-20-24(18(12)23-14)19-16(26)15(25)13(31-19)9-30-10(2)32(27,28)29/h8,10-11,13,15-16,19,25-26H,3-7,9H2,1-2H3,(H,21,22,23)(H2,27,28,29)/t10?,13-,15-,16-,19-/m1/s1 |
| InChIKey | BWKYKTQMJNWIDD-JTXMXDKBSA-N |
| XLogP | 0.90 |
| TPSA | 172.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.45 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|