C22H32N5O9P — CID 148789414
[1-[[(2R,3S,4R,5R)-5-[4-(cyclopentylamino)-6-[(3R)-3-hydroxybut-1-ynyl]pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-2-methoxyethyl]phosphonic acid (PubChem CID 148789414) has the molecular formula C22H32N5O9P and a molecular weight of 541.50 g/mol. Its IUPAC name is [1-[[(2R,3S,4R,5R)-5-[4-(cyclopentylamino)-6-[(3R)-3-hydroxybut-1-ynyl]pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-2-methoxyethyl]phosphonic acid.
| Compound Name | [1-[[(2R,3S,4R,5R)-5-[4-(cyclopentylamino)-6-[(3R)-3-hydroxybut-1-ynyl]pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-2-methoxyethyl]phosphonic acid |
|---|---|
| PubChem CID | 148789414 |
| Molecular Formula | C22H32N5O9P |
| Molecular Weight | 541.50 g/mol |
| Exact Mass | 541.19 |
| IUPAC Name | [1-[[(2R,3S,4R,5R)-5-[4-(cyclopentylamino)-6-[(3R)-3-hydroxybut-1-ynyl]pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-2-methoxyethyl]phosphonic acid |
| SMILES | COCC(OC[C@H]1O[C@@H](n2ncc3c(NC4CCCC4)nc(C#C[C@@H](C)O)nc32)[C@H](O)[C@@H]1O)P(=O)(O)O |
| InChI | InChI=1S/C22H32N5O9P/c1-12(28)7-8-16-25-20(24-13-5-3-4-6-13)14-9-23-27(21(14)26-16)22-19(30)18(29)15(36-22)10-35-17(11-34-2)37(31,32)33/h9,12-13,15,17-19,22,28-30H,3-6,10-11H2,1-2H3,(H,24,25,26)(H2,31,32,33)/t12-,15-,17?,18-,19-,22-/m1/s1 |
| InChIKey | OLWCLZSJGCWQID-VPFGQOFOSA-N |
| XLogP | -0.30 |
| TPSA | 201.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.50 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|