C20H28N5O7P — CID 153359024
[1-[[5-[4-(cyclopentylamino)-6-(3-hydroxyprop-1-ynyl)pyrazolo[3,4-d]pyrimidin-1-yl]oxolan-2-yl]methoxy]-2-hydroxyethyl]phosphonic acid (PubChem CID 153359024) has the molecular formula C20H28N5O7P and a molecular weight of 481.45 g/mol. Its IUPAC name is [1-[[5-[4-(cyclopentylamino)-6-(3-hydroxyprop-1-ynyl)pyrazolo[3,4-d]pyrimidin-1-yl]oxolan-2-yl]methoxy]-2-hydroxyethyl]phosphonic acid.
| Compound Name | [1-[[5-[4-(cyclopentylamino)-6-(3-hydroxyprop-1-ynyl)pyrazolo[3,4-d]pyrimidin-1-yl]oxolan-2-yl]methoxy]-2-hydroxyethyl]phosphonic acid |
|---|---|
| PubChem CID | 153359024 |
| Molecular Formula | C20H28N5O7P |
| Molecular Weight | 481.45 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | [1-[[5-[4-(cyclopentylamino)-6-(3-hydroxyprop-1-ynyl)pyrazolo[3,4-d]pyrimidin-1-yl]oxolan-2-yl]methoxy]-2-hydroxyethyl]phosphonic acid |
| SMILES | O=P(O)(O)C(CO)OCC1CCC(n2ncc3c(NC4CCCC4)nc(C#CCO)nc32)O1 |
| InChI | InChI=1S/C20H28N5O7P/c26-9-3-6-16-23-19(22-13-4-1-2-5-13)15-10-21-25(20(15)24-16)17-8-7-14(32-17)12-31-18(11-27)33(28,29)30/h10,13-14,17-18,26-27H,1-2,4-5,7-9,11-12H2,(H,22,23,24)(H2,28,29,30) |
| InChIKey | RTMCNOLJDWSOQU-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 172.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.45 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|