C18H27ClN4O9P2 — CID 167191354
[[(2R,3S,4R,5R)-5-[[2-chloro-4-(cyclopentylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]methyl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 167191354) has the molecular formula C18H27ClN4O9P2 and a molecular weight of 540.83 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-[[2-chloro-4-(cyclopentylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]methyl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2R,3S,4R,5R)-5-[[2-chloro-4-(cyclopentylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]methyl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 167191354 |
| Molecular Formula | C18H27ClN4O9P2 |
| Molecular Weight | 540.83 g/mol |
| Exact Mass | 540.09 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-[[2-chloro-4-(cyclopentylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]methyl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | O=P(O)(O)CP(=O)(O)OC[C@H]1O[C@H](Cc2ccc3c(NC4CCCC4)nc(Cl)nn23)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H27ClN4O9P2/c19-18-21-17(20-10-3-1-2-4-10)12-6-5-11(23(12)22-18)7-13-15(24)16(25)14(32-13)8-31-34(29,30)9-33(26,27)28/h5-6,10,13-16,24-25H,1-4,7-9H2,(H,29,30)(H,20,21,22)(H2,26,27,28)/t13-,14-,15+,16-/m1/s1 |
| InChIKey | VGLXKXDPBPEGTD-LVQVYYBASA-N |
| XLogP | 1.11 |
| TPSA | 195.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.83 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|